Compound Q&A

What precautions should be taken when handling 4-Hydroxy-3-quinolinecarboxylic acid (CAS: 13721-01-2)?

Answer

4-Hydroxy-3-quinolinecarboxylic acid
Proper handling of 4-Hydroxy-3-quinolinecarboxylic acid (CAS: 13721-01-2) requires the use of personal protective equipment (PPE) such as gloves, goggles, and a lab coat. It should be handled in a well-ventilated area or within a fume hood due to its potential for releasing toxic vapors. In case of a spill, the area should be immediately flushed with water and the affected area cleaned properly. Always refer to the Safety Data Sheet (SDS) for detailed handling and disposal instructions.

About

CAS No 13721-01-2
English Name 4-Hydroxy-3-quinolinecarboxylic acid
Molecular Formula C10H7NO3
Molecular Weight 189.17 g/mol
SMILES C1=CC=C2C(=C1)C(=O)C(=CN2)C(=O)O
InChIKey ILNJBIQQAIIMEY-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Hydroxy-3-quinolinecarboxylic acid (CAS: 13721-01-2)?

4-Hydroxy-3-quinolinecarboxylic acid (CAS: 13721-01-2) is a crystalline solid with a molecular weigh...

Compound Q&A

How is 4-Hydroxy-3-quinolinecarboxylic acid (CAS: 13721-01-2) typically synthesized?

4-Hydroxy-3-quinolinecarboxylic acid (CAS: 13721-01-2) is typically synthesized through the reaction...

Compound Q&A

What industries use 4-Hydroxy-3-quinolinecarboxylic acid (CAS: 13721-01-2)?

4-Hydroxy-3-quinolinecarboxylic acid (CAS: 13721-01-2) is used in the pharmaceutical industry for th...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...