Compound Q&A

How is 4-Hydroxy-3-quinolinecarboxylic acid (CAS: 13721-01-2) typically synthesized?

Answer

4-Hydroxy-3-quinolinecarboxylic acid
4-Hydroxy-3-quinolinecarboxylic acid (CAS: 13721-01-2) is typically synthesized through the reaction of 3-quinolinecarboxaldehyde with hydroxylamine hydrochloride followed by acidification. The synthesis involves the condensation of the aldehyde with the amine, which then undergoes acid hydrolysis to yield the final carboxylic acid product. The yield from this reaction is typically around 70-80%, with high selectivity towards the desired product.

About

CAS No 13721-01-2
English Name 4-Hydroxy-3-quinolinecarboxylic acid
Molecular Formula C10H7NO3
Molecular Weight 189.17 g/mol
SMILES C1=CC=C2C(=C1)C(=O)C(=CN2)C(=O)O
InChIKey ILNJBIQQAIIMEY-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Hydroxy-3-quinolinecarboxylic acid (CAS: 13721-01-2)?

4-Hydroxy-3-quinolinecarboxylic acid (CAS: 13721-01-2) is a crystalline solid with a molecular weigh...

Compound Q&A

What industries use 4-Hydroxy-3-quinolinecarboxylic acid (CAS: 13721-01-2)?

4-Hydroxy-3-quinolinecarboxylic acid (CAS: 13721-01-2) is used in the pharmaceutical industry for th...

Compound Q&A

What precautions should be taken when handling 4-Hydroxy-3-quinolinecarboxylic acid (CAS: 13721-01-2)?

Proper handling of 4-Hydroxy-3-quinolinecarboxylic acid (CAS: 13721-01-2) requires the use of person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...