Compound Q&A

What are the physical and chemical properties of 4-Hydroxy-3-quinolinecarboxylic acid (CAS: 13721-01-2)?

Answer

4-Hydroxy-3-quinolinecarboxylic acid
4-Hydroxy-3-quinolinecarboxylic acid (CAS: 13721-01-2) is a crystalline solid with a molecular weight of approximately 181.16 g/mol. It is poorly soluble in water but soluble in many organic solvents. The compound is highly reactive and forms complexes with various metal ions. It is known for its acid functionality and can undergo various chemical reactions such as esterification and condensation.

About

CAS No 13721-01-2
English Name 4-Hydroxy-3-quinolinecarboxylic acid
Molecular Formula C10H7NO3
Molecular Weight 189.17 g/mol
SMILES C1=CC=C2C(=C1)C(=O)C(=CN2)C(=O)O
InChIKey ILNJBIQQAIIMEY-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is 4-Hydroxy-3-quinolinecarboxylic acid (CAS: 13721-01-2) typically synthesized?

4-Hydroxy-3-quinolinecarboxylic acid (CAS: 13721-01-2) is typically synthesized through the reaction...

Compound Q&A

What industries use 4-Hydroxy-3-quinolinecarboxylic acid (CAS: 13721-01-2)?

4-Hydroxy-3-quinolinecarboxylic acid (CAS: 13721-01-2) is used in the pharmaceutical industry for th...

Compound Q&A

What precautions should be taken when handling 4-Hydroxy-3-quinolinecarboxylic acid (CAS: 13721-01-2)?

Proper handling of 4-Hydroxy-3-quinolinecarboxylic acid (CAS: 13721-01-2) requires the use of person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...