Compound Q&A

What precautions should be taken when handling 4-[2-(4-Hydroxyphenyl)-2-propanyl]phenyl hydrogen carbonate (CAS: 25037-45-0)?

Answer

4-[2-(4-Hydroxyphenyl)-2-propanyl]phenyl hydrogen carbonate
When handling 4-[2-(4-Hydroxyphenyl)-2-propanyl]phenyl hydrogen carbonate (CAS: 25037-45-0), safety should be the primary concern. Always wear appropriate personal protective equipment (PPE), including gloves and safety goggles. Store the compound under dry conditions away from heat and light. Use a fume hood during handling to minimize exposure. Follow standard laboratory safety protocols and refer to the Safety Data Sheet (SDS) for detailed information on handling and storage.

About

CAS No 25037-45-0
English Name 4-[2-(4-Hydroxyphenyl)-2-propanyl]phenyl hydrogen carbonate
Molecular Formula C16H16O4
Molecular Weight 272.3 g/mol
SMILES CC(C)(C1=CC=C(C=C1)O)C2=CC=C(C=C2)O.C(=O)(O)O
InChIKey PWULOAPIBVMKBN-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-[2-(4-Hydroxyphenyl)-2-propanyl]phenyl hydrogen carbonate (CAS: 25037-45-0)?

4-[2-(4-Hydroxyphenyl)-2-propanyl]phenyl hydrogen carbonate (CAS: 25037-45-0) is a solid with a crys...

Compound Q&A

How is 4-[2-(4-Hydroxyphenyl)-2-propanyl]phenyl hydrogen carbonate (CAS: 25037-45-0) typically synthesized?

4-[2-(4-Hydroxyphenyl)-2-propanyl]phenyl hydrogen carbonate (CAS: 25037-45-0) is typically synthesiz...

Compound Q&A

What industries use 4-[2-(4-Hydroxyphenyl)-2-propanyl]phenyl hydrogen carbonate (CAS: 25037-45-0)?

4-[2-(4-Hydroxyphenyl)-2-propanyl]phenyl hydrogen carbonate (CAS: 25037-45-0) is used in various ind...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...