Compound Q&A

How is 4-[2-(4-Hydroxyphenyl)-2-propanyl]phenyl hydrogen carbonate (CAS: 25037-45-0) typically synthesized?

Answer

4-[2-(4-Hydroxyphenyl)-2-propanyl]phenyl hydrogen carbonate
4-[2-(4-Hydroxyphenyl)-2-propanyl]phenyl hydrogen carbonate (CAS: 25037-45-0) is typically synthesized through a multistep process involving the coupling of a 4-hydroxyphenyl propyl bromide with a phenol derivative followed by hydrogenation. Common catalysts include palladium on carbon, and the reaction conditions are optimized for high selectivity and yield. Detailed procedures can be found in the literature.

About

CAS No 25037-45-0
English Name 4-[2-(4-Hydroxyphenyl)-2-propanyl]phenyl hydrogen carbonate
Molecular Formula C16H16O4
Molecular Weight 272.3 g/mol
SMILES CC(C)(C1=CC=C(C=C1)O)C2=CC=C(C=C2)O.C(=O)(O)O
InChIKey PWULOAPIBVMKBN-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-[2-(4-Hydroxyphenyl)-2-propanyl]phenyl hydrogen carbonate (CAS: 25037-45-0)?

4-[2-(4-Hydroxyphenyl)-2-propanyl]phenyl hydrogen carbonate (CAS: 25037-45-0) is a solid with a crys...

Compound Q&A

What industries use 4-[2-(4-Hydroxyphenyl)-2-propanyl]phenyl hydrogen carbonate (CAS: 25037-45-0)?

4-[2-(4-Hydroxyphenyl)-2-propanyl]phenyl hydrogen carbonate (CAS: 25037-45-0) is used in various ind...

Compound Q&A

What precautions should be taken when handling 4-[2-(4-Hydroxyphenyl)-2-propanyl]phenyl hydrogen carbonate (CAS: 25037-45-0)?

When handling 4-[2-(4-Hydroxyphenyl)-2-propanyl]phenyl hydrogen carbonate (CAS: 25037-45-0), safety ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...