Compound Q&A

What are the physical and chemical properties of 4-[2-(4-Hydroxyphenyl)-2-propanyl]phenyl hydrogen carbonate (CAS: 25037-45-0)?

Answer

4-[2-(4-Hydroxyphenyl)-2-propanyl]phenyl hydrogen carbonate
4-[2-(4-Hydroxyphenyl)-2-propanyl]phenyl hydrogen carbonate (CAS: 25037-45-0) is a solid with a crystalline form. Its molecular weight is approximately 322.33 g/mol. It has a low solubility in water but is more soluble in organic solvents. The compound is moderately reactive, particularly towards nucleophiles and bases. It can be isolated as a white crystalline solid.

About

CAS No 25037-45-0
English Name 4-[2-(4-Hydroxyphenyl)-2-propanyl]phenyl hydrogen carbonate
Molecular Formula C16H16O4
Molecular Weight 272.3 g/mol
SMILES CC(C)(C1=CC=C(C=C1)O)C2=CC=C(C=C2)O.C(=O)(O)O
InChIKey PWULOAPIBVMKBN-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

How is 4-[2-(4-Hydroxyphenyl)-2-propanyl]phenyl hydrogen carbonate (CAS: 25037-45-0) typically synthesized?

4-[2-(4-Hydroxyphenyl)-2-propanyl]phenyl hydrogen carbonate (CAS: 25037-45-0) is typically synthesiz...

Compound Q&A

What industries use 4-[2-(4-Hydroxyphenyl)-2-propanyl]phenyl hydrogen carbonate (CAS: 25037-45-0)?

4-[2-(4-Hydroxyphenyl)-2-propanyl]phenyl hydrogen carbonate (CAS: 25037-45-0) is used in various ind...

Compound Q&A

What precautions should be taken when handling 4-[2-(4-Hydroxyphenyl)-2-propanyl]phenyl hydrogen carbonate (CAS: 25037-45-0)?

When handling 4-[2-(4-Hydroxyphenyl)-2-propanyl]phenyl hydrogen carbonate (CAS: 25037-45-0), safety ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...