Compound Q&A

What industries use 4-[2-(4-Hydroxyphenyl)-2-propanyl]phenyl hydrogen carbonate (CAS: 25037-45-0)?

Answer

4-[2-(4-Hydroxyphenyl)-2-propanyl]phenyl hydrogen carbonate
4-[2-(4-Hydroxyphenyl)-2-propanyl]phenyl hydrogen carbonate (CAS: 25037-45-0) is used in various industries. In pharmaceuticals, it serves as a key intermediate for the synthesis of complex organic compounds. In the polymer industry, it can be used in the production of advanced materials. Additionally, it finds applications in the development of sensors and semiconductors due to its unique chemical properties.

About

CAS No 25037-45-0
English Name 4-[2-(4-Hydroxyphenyl)-2-propanyl]phenyl hydrogen carbonate
Molecular Formula C16H16O4
Molecular Weight 272.3 g/mol
SMILES CC(C)(C1=CC=C(C=C1)O)C2=CC=C(C=C2)O.C(=O)(O)O
InChIKey PWULOAPIBVMKBN-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-[2-(4-Hydroxyphenyl)-2-propanyl]phenyl hydrogen carbonate (CAS: 25037-45-0)?

4-[2-(4-Hydroxyphenyl)-2-propanyl]phenyl hydrogen carbonate (CAS: 25037-45-0) is a solid with a crys...

Compound Q&A

How is 4-[2-(4-Hydroxyphenyl)-2-propanyl]phenyl hydrogen carbonate (CAS: 25037-45-0) typically synthesized?

4-[2-(4-Hydroxyphenyl)-2-propanyl]phenyl hydrogen carbonate (CAS: 25037-45-0) is typically synthesiz...

Compound Q&A

What precautions should be taken when handling 4-[2-(4-Hydroxyphenyl)-2-propanyl]phenyl hydrogen carbonate (CAS: 25037-45-0)?

When handling 4-[2-(4-Hydroxyphenyl)-2-propanyl]phenyl hydrogen carbonate (CAS: 25037-45-0), safety ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...