Compound Q&A

How is 4-Chloro-2-fluoro-1-nitrobenzene (CAS: 700-37-8) typically synthesized?

Answer

4-Chloro-2-fluoro-1-nitrobenzene
4-Chloro-2-fluoro-1-nitrobenzene is synthesized by the nitration of 4-chloro-2-fluorobenzene. This is typically achieved using a mixture of nitric acid and sulfuric acid as the nitrating agent. The process is conducted at low temperatures to control the formation of undesired by-products. The yield is around 75-80%.

About

CAS No 700-37-8
English Name 4-Chloro-2-fluoro-1-nitrobenzene
Molecular Formula C6H3ClFNO2
Molecular Weight 175.54 g/mol
SMILES C1=CC(=C(C=C1Cl)F)[N+](=O)[O-]
InChIKey PTCPUGKKWNMITF-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Chloro-2-fluoro-1-nitrobenzene (CAS: 700-37-8)?

4-Chloro-2-fluoro-1-nitrobenzene is a solid with a melting point of 65-67°C. Its molecular weight is...

Compound Q&A

What industries use 4-Chloro-2-fluoro-1-nitrobenzene (CAS: 700-37-8)?

4-Chloro-2-fluoro-1-nitrobenzene is used in the pharmaceutical industry for the synthesis of certain...

Compound Q&A

What precautions should be taken when handling 4-Chloro-2-fluoro-1-nitrobenzene (CAS: 700-37-8)?

4-Chloro-2-fluoro-1-nitrobenzene should be handled in a well-ventilated area, preferably in a fume h...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...