Compound Q&A

What are the physical and chemical properties of 4-Chloro-2-fluoro-1-nitrobenzene (CAS: 700-37-8)?

Answer

4-Chloro-2-fluoro-1-nitrobenzene
4-Chloro-2-fluoro-1-nitrobenzene is a solid with a melting point of 65-67°C. Its molecular weight is 194.01 g/mol. It is slightly soluble in water and readily soluble in organic solvents such as ethanol and acetone. It reacts readily with reducing agents and can undergo substitution reactions. This compound is used in the synthesis of other organic compounds.

About

CAS No 700-37-8
English Name 4-Chloro-2-fluoro-1-nitrobenzene
Molecular Formula C6H3ClFNO2
Molecular Weight 175.54 g/mol
SMILES C1=CC(=C(C=C1Cl)F)[N+](=O)[O-]
InChIKey PTCPUGKKWNMITF-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

How is 4-Chloro-2-fluoro-1-nitrobenzene (CAS: 700-37-8) typically synthesized?

4-Chloro-2-fluoro-1-nitrobenzene is synthesized by the nitration of 4-chloro-2-fluorobenzene. This i...

Compound Q&A

What industries use 4-Chloro-2-fluoro-1-nitrobenzene (CAS: 700-37-8)?

4-Chloro-2-fluoro-1-nitrobenzene is used in the pharmaceutical industry for the synthesis of certain...

Compound Q&A

What precautions should be taken when handling 4-Chloro-2-fluoro-1-nitrobenzene (CAS: 700-37-8)?

4-Chloro-2-fluoro-1-nitrobenzene should be handled in a well-ventilated area, preferably in a fume h...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...