Compound Q&A

What precautions should be taken when handling Cerium(4+) disulfate (CAS: 13590-82-4)?

Answer

Cerium(4+) disulfate
When handling Cerium(4+) disulfate (CAS: 13590-82-4), it is crucial to wear appropriate personal protective equipment (PPE), including gloves, safety goggles, and a lab coat. The material should be stored in a dry, well-ventilated area. If a spill occurs, it should be carefully cleaned up using a spill kit. Always consult the Safety Data Sheet (SDS) for detailed handling instructions and emergency procedures.

About

CAS No 13590-82-4
English Name Cerium(4+) disulfate
Molecular Formula CeO8S2
Molecular Weight 332.25 g/mol
SMILES [O-]S(=O)(=O)[O-].[O-]S(=O)(=O)[O-].[Ce+4]
InChIKey VZDYWEUILIUIDF-UHFFFAOYSA-J
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

What are the physical and chemical properties of Cerium(4+) disulfate (CAS: 13590-82-4)?

Cerium(4+) disulfate (CAS: 13590-82-4) has a crystalline form and a molecular weight of approximatel...

Compound Q&A

How is Cerium(4+) disulfate (CAS: 13590-82-4) typically synthesized?

Cerium(4+) disulfate (CAS: 13590-82-4) can be synthesized through the reaction of cerium(IV) oxide w...

Compound Q&A

What industries use Cerium(4+) disulfate (CAS: 13590-82-4)?

Cerium(4+) disulfate (CAS: 13590-82-4) finds applications in various industries. It is used in the p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...