Compound Q&A

How is Cerium(4+) disulfate (CAS: 13590-82-4) typically synthesized?

Answer

Cerium(4+) disulfate
Cerium(4+) disulfate (CAS: 13590-82-4) can be synthesized through the reaction of cerium(IV) oxide with sulfuric acid. Commonly, cerium(IV) oxide is dissolved in concentrated sulfuric acid, followed by the addition of excess sulfuric acid to form the disulfate salt. The process is typically carried out in a fume hood with proper personal protective equipment.

About

CAS No 13590-82-4
English Name Cerium(4+) disulfate
Molecular Formula CeO8S2
Molecular Weight 332.25 g/mol
SMILES [O-]S(=O)(=O)[O-].[O-]S(=O)(=O)[O-].[Ce+4]
InChIKey VZDYWEUILIUIDF-UHFFFAOYSA-J
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

What are the physical and chemical properties of Cerium(4+) disulfate (CAS: 13590-82-4)?

Cerium(4+) disulfate (CAS: 13590-82-4) has a crystalline form and a molecular weight of approximatel...

Compound Q&A

What industries use Cerium(4+) disulfate (CAS: 13590-82-4)?

Cerium(4+) disulfate (CAS: 13590-82-4) finds applications in various industries. It is used in the p...

Compound Q&A

What precautions should be taken when handling Cerium(4+) disulfate (CAS: 13590-82-4)?

When handling Cerium(4+) disulfate (CAS: 13590-82-4), it is crucial to wear appropriate personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...