Compound Q&A

What are the physical and chemical properties of Cerium(4+) disulfate (CAS: 13590-82-4)?

Answer

Cerium(4+) disulfate
Cerium(4+) disulfate (CAS: 13590-82-4) has a crystalline form and a molecular weight of approximately 556.51 g/mol. It is poorly soluble in water. The compound shows limited reactivity under normal conditions but can interact with strong reducing agents. It is stable under normal laboratory conditions but should be stored in a dry environment to prevent hygroscopic behavior.

About

CAS No 13590-82-4
English Name Cerium(4+) disulfate
Molecular Formula CeO8S2
Molecular Weight 332.25 g/mol
SMILES [O-]S(=O)(=O)[O-].[O-]S(=O)(=O)[O-].[Ce+4]
InChIKey VZDYWEUILIUIDF-UHFFFAOYSA-J
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

How is Cerium(4+) disulfate (CAS: 13590-82-4) typically synthesized?

Cerium(4+) disulfate (CAS: 13590-82-4) can be synthesized through the reaction of cerium(IV) oxide w...

Compound Q&A

What industries use Cerium(4+) disulfate (CAS: 13590-82-4)?

Cerium(4+) disulfate (CAS: 13590-82-4) finds applications in various industries. It is used in the p...

Compound Q&A

What precautions should be taken when handling Cerium(4+) disulfate (CAS: 13590-82-4)?

When handling Cerium(4+) disulfate (CAS: 13590-82-4), it is crucial to wear appropriate personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...