Compound Q&A

What industries use Cerium(4+) disulfate (CAS: 13590-82-4)?

Answer

Cerium(4+) disulfate
Cerium(4+) disulfate (CAS: 13590-82-4) finds applications in various industries. It is used in the production of cerium-based catalysts for the refining of hydrocarbons, as a component in some glass and ceramic production, and in the manufacturing of certain types of pigments. Additionally, it is used in the electronics industry for the fabrication of semiconductor materials and as an additive in some polymer formulations.

About

CAS No 13590-82-4
English Name Cerium(4+) disulfate
Molecular Formula CeO8S2
Molecular Weight 332.25 g/mol
SMILES [O-]S(=O)(=O)[O-].[O-]S(=O)(=O)[O-].[Ce+4]
InChIKey VZDYWEUILIUIDF-UHFFFAOYSA-J
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

What are the physical and chemical properties of Cerium(4+) disulfate (CAS: 13590-82-4)?

Cerium(4+) disulfate (CAS: 13590-82-4) has a crystalline form and a molecular weight of approximatel...

Compound Q&A

How is Cerium(4+) disulfate (CAS: 13590-82-4) typically synthesized?

Cerium(4+) disulfate (CAS: 13590-82-4) can be synthesized through the reaction of cerium(IV) oxide w...

Compound Q&A

What precautions should be taken when handling Cerium(4+) disulfate (CAS: 13590-82-4)?

When handling Cerium(4+) disulfate (CAS: 13590-82-4), it is crucial to wear appropriate personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...