Compound Q&A

What industries use Desquinolinyl Lenvatinib (CAS: 796848-79-8)?

Answer

Desquinolinyl Lenvatinib (CAS: 796848-79-8) is primarily used in the pharmaceutical industry for its potential as an anticancer agent. It is also explored in research for its applications in molecular imaging and as a component in certain polymer-based drug delivery systems.

About

CAS No 796848-79-8

English Name Desquinolinyl Lenvatinib

Molecular Formula C10H11ClN2O2

Molecular Weight 226.66 g/mol

SMILES C1CC1NC(=O)NC2=C(C=C(C=C2)O)Cl

InChIKey QVPZNUIZEVRITP-UHFFFAOYSA-N

Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

What are the physical and chemical properties of Desquinolinyl Lenvatinib (CAS: 796848-79-8)?

Desquinolinyl Lenvatinib (CAS: 796848-79-8) is a crystalline compound with a molecular weight of app...

Compound Q&A

How is Desquinolinyl Lenvatinib (CAS: 796848-79-8) typically synthesized?

Desquinolinyl Lenvatinib (CAS: 796848-79-8) is synthesized via a multi-step process involving the co...

Compound Q&A

What precautions should be taken when handling Desquinolinyl Lenvatinib (CAS: 796848-79-8)?

When handling Desquinolinyl Lenvatinib (CAS: 796848-79-8), it is important to use personal protectiv...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...

Compound Q&A

How should (1R,9S,10S,12S,14E,16S,19R,20R,21S,22R)-3,9,21-Trihydroxy-5,10,12,14,16,20,22-heptamethyl-23,24-dioxatetracyclo[17.3.1.1~6,9~.0~2,7~]tetracosa-2,5,7,14-tetraen-4-one (CAS: 183202-73-5) be stored?

This compound should be stored in a cool, dry place away from direct sunlight. I...

183202-73-5(1R,9S,10S,12S,14E,1...

Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...

Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...

What industries use Desquinolinyl Lenvatinib (CAS: 796848-79-8)?

Answer

About

Related Q&A

What are the physical and chemical properties of Desquinolinyl Lenvatinib (CAS: 796848-79-8)?

How is Desquinolinyl Lenvatinib (CAS: 796848-79-8) typically synthesized?

What precautions should be taken when handling Desquinolinyl Lenvatinib (CAS: 796848-79-8)?

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

How should (1R,9S,10S,12S,14E,16S,19R,20R,21S,22R)-3,9,21-Trihydroxy-5,10,12,14,16,20,22-heptamethyl-23,24-dioxatetracyclo[17.3.1.1~6,9~.0~2,7~]tetracosa-2,5,7,14-tetraen-4-one (CAS: 183202-73-5) be stored?

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

Suppliers

Shanghai Jinghao Pharmaceutical Technology Co., Ltd.

JiNaYingChuang Chemical Co Ltd

Shandong Xande Pharmaceutical Technology Co., Ltd.

Jinan Yuantai Chemical Co., Ltd.

Shanghai Xiangshu Li Technology Co., Ltd.

Nantong Zhonghe Chemical New Materials Co., Ltd.