Compound Q&A

What are the physical and chemical properties of Desquinolinyl Lenvatinib (CAS: 796848-79-8)?

Answer

Desquinolinyl Lenvatinib
Desquinolinyl Lenvatinib (CAS: 796848-79-8) is a crystalline compound with a molecular weight of approximately 392.41 g/mol. It has a solubility of about 1 mg/mL in water. This compound is relatively stable under normal conditions but can react with strong acids to form salts. It is generally insoluble in common organic solvents such as chloroform and dichloromethane.

About

English Name Desquinolinyl Lenvatinib
Molecular Formula C10H11ClN2O2
Molecular Weight 226.66 g/mol
SMILES C1CC1NC(=O)NC2=C(C=C(C=C2)O)Cl
InChIKey QVPZNUIZEVRITP-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

How is Desquinolinyl Lenvatinib (CAS: 796848-79-8) typically synthesized?

Desquinolinyl Lenvatinib (CAS: 796848-79-8) is synthesized via a multi-step process involving the co...

Compound Q&A

What industries use Desquinolinyl Lenvatinib (CAS: 796848-79-8)?

Desquinolinyl Lenvatinib (CAS: 796848-79-8) is primarily used in the pharmaceutical industry for its...

Compound Q&A

What precautions should be taken when handling Desquinolinyl Lenvatinib (CAS: 796848-79-8)?

When handling Desquinolinyl Lenvatinib (CAS: 796848-79-8), it is important to use personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...