Compound Q&A

How is Desquinolinyl Lenvatinib (CAS: 796848-79-8) typically synthesized?

Answer

Desquinolinyl Lenvatinib
Desquinolinyl Lenvatinib (CAS: 796848-79-8) is synthesized via a multi-step process involving the condensation of quinoline derivatives with a suitable amine. The reaction typically requires a base and is carried out in an aprotic solvent. The yield is around 70%, and the reaction is selective with high purity products.

About

English Name Desquinolinyl Lenvatinib
Molecular Formula C10H11ClN2O2
Molecular Weight 226.66 g/mol
SMILES C1CC1NC(=O)NC2=C(C=C(C=C2)O)Cl
InChIKey QVPZNUIZEVRITP-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

What are the physical and chemical properties of Desquinolinyl Lenvatinib (CAS: 796848-79-8)?

Desquinolinyl Lenvatinib (CAS: 796848-79-8) is a crystalline compound with a molecular weight of app...

Compound Q&A

What industries use Desquinolinyl Lenvatinib (CAS: 796848-79-8)?

Desquinolinyl Lenvatinib (CAS: 796848-79-8) is primarily used in the pharmaceutical industry for its...

Compound Q&A

What precautions should be taken when handling Desquinolinyl Lenvatinib (CAS: 796848-79-8)?

When handling Desquinolinyl Lenvatinib (CAS: 796848-79-8), it is important to use personal protectiv...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...