Compound Q&A

What industries use 3-Nitro-4-pyridinol (CAS: 5435-54-1)?

Answer

3-Nitro-4-pyridinol
3-Nitro-4-pyridinol is primarily used in the pharmaceutical industry as a precursor for the synthesis of various pyridine derivatives with potential medicinal applications. It is also used in the chemical industry for the production of dyes, pigments, and other organic compounds. Additionally, it finds applications in the development of sensors and as a reagent in organic synthesis.

About

CAS No 5435-54-1
English Name 3-Nitro-4-pyridinol
Molecular Formula C5H4N2O3
Molecular Weight 140.1 g/mol
SMILES C1=CNC=C(C1=O)[N+](=O)[O-]
InChIKey YUWOLBZMQDGRFV-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Nitro-4-pyridinol (CAS: 5435-54-1)?

3-Nitro-4-pyridinol is a crystalline compound with a molecular weight of 165.11 g/mol. It has a solu...

Compound Q&A

How is 3-Nitro-4-pyridinol (CAS: 5435-54-1) typically synthesized?

3-Nitro-4-pyridinol is usually synthesized by the nitration of 4-pyridol or 3-pyridol. The nitration...

Compound Q&A

What precautions should be taken when handling 3-Nitro-4-pyridinol (CAS: 5435-54-1)?

When handling 3-Nitro-4-pyridinol, it is crucial to use personal protective equipment (PPE) includin...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...