Compound Q&A

How is 3-Nitro-4-pyridinol (CAS: 5435-54-1) typically synthesized?

Answer

3-Nitro-4-pyridinol
3-Nitro-4-pyridinol is usually synthesized by the nitration of 4-pyridol or 3-pyridol. The nitration reaction involves treating the pyridol with concentrated nitric acid in the presence of a catalyst like sulfuric acid. The yield is typically around 70-80%, and the reaction is carried out under controlled temperature conditions to ensure high purity and selectivity.

About

CAS No 5435-54-1
English Name 3-Nitro-4-pyridinol
Molecular Formula C5H4N2O3
Molecular Weight 140.1 g/mol
SMILES C1=CNC=C(C1=O)[N+](=O)[O-]
InChIKey YUWOLBZMQDGRFV-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Nitro-4-pyridinol (CAS: 5435-54-1)?

3-Nitro-4-pyridinol is a crystalline compound with a molecular weight of 165.11 g/mol. It has a solu...

Compound Q&A

What industries use 3-Nitro-4-pyridinol (CAS: 5435-54-1)?

3-Nitro-4-pyridinol is primarily used in the pharmaceutical industry as a precursor for the synthesi...

Compound Q&A

What precautions should be taken when handling 3-Nitro-4-pyridinol (CAS: 5435-54-1)?

When handling 3-Nitro-4-pyridinol, it is crucial to use personal protective equipment (PPE) includin...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...