Compound Q&A

What industries use Diphenylphosphinic acid (CAS: 1707-03-5)?

Answer

Diphenylphosphinic acid
Diphenylphosphinic acid (CAS: 1707-03-5) is used in various industries, including pharmaceuticals for the synthesis of certain drugs, polymers for the modification of materials, sensors for chemical detection, and semiconductors for electronic applications. Its acidic nature makes it valuable in these sectors for catalysis, derivatization, and analytical purposes.

About

CAS No 1707-03-5
English Name Diphenylphosphinic acid
Molecular Formula C12H11O2P
Molecular Weight 218.19 g/mol
SMILES C1=CC=C(C=C1)P(=O)(C2=CC=CC=C2)O
InChIKey BEQVQKJCLJBTKZ-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of Diphenylphosphinic acid (CAS: 1707-03-5)?

Diphenylphosphinic acid (CAS: 1707-03-5) is a crystalline compound with a molecular weight of approx...

Compound Q&A

How is Diphenylphosphinic acid (CAS: 1707-03-5) typically synthesized?

Diphenylphosphinic acid is typically synthesized by the reaction of phenylphosphine with phosphorus ...

Compound Q&A

What precautions should be taken when handling Diphenylphosphinic acid (CAS: 1707-03-5)?

When handling Diphenylphosphinic acid (CAS: 1707-03-5), it is important to use personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...