Compound Q&A

How is Diphenylphosphinic acid (CAS: 1707-03-5) typically synthesized?

Answer

Diphenylphosphinic acid
Diphenylphosphinic acid is typically synthesized by the reaction of phenylphosphine with phosphorus trichloride, followed by hydrolysis. The reaction involves the conversion of phenylphosphine to phosphorus oxychloride, which then reacts with water to form the acid. This process requires careful control of temperature and pressure to achieve high yield and selectivity.

About

CAS No 1707-03-5
English Name Diphenylphosphinic acid
Molecular Formula C12H11O2P
Molecular Weight 218.19 g/mol
SMILES C1=CC=C(C=C1)P(=O)(C2=CC=CC=C2)O
InChIKey BEQVQKJCLJBTKZ-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of Diphenylphosphinic acid (CAS: 1707-03-5)?

Diphenylphosphinic acid (CAS: 1707-03-5) is a crystalline compound with a molecular weight of approx...

Compound Q&A

What industries use Diphenylphosphinic acid (CAS: 1707-03-5)?

Diphenylphosphinic acid (CAS: 1707-03-5) is used in various industries, including pharmaceuticals fo...

Compound Q&A

What precautions should be taken when handling Diphenylphosphinic acid (CAS: 1707-03-5)?

When handling Diphenylphosphinic acid (CAS: 1707-03-5), it is important to use personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...