Compound Q&A

What are the physical and chemical properties of Diphenylphosphinic acid (CAS: 1707-03-5)?

Answer

Diphenylphosphinic acid
Diphenylphosphinic acid (CAS: 1707-03-5) is a crystalline compound with a molecular weight of approximately 250.25 g/mol. It is slightly soluble in water and ethanol. Chemically, it is known for its acidity and reactivity towards various functional groups, making it useful in organic synthesis and analytical chemistry. It has a melting point of 104-105°C and a density of 1.32 g/cm³.

About

CAS No 1707-03-5
English Name Diphenylphosphinic acid
Molecular Formula C12H11O2P
Molecular Weight 218.19 g/mol
SMILES C1=CC=C(C=C1)P(=O)(C2=CC=CC=C2)O
InChIKey BEQVQKJCLJBTKZ-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

How is Diphenylphosphinic acid (CAS: 1707-03-5) typically synthesized?

Diphenylphosphinic acid is typically synthesized by the reaction of phenylphosphine with phosphorus ...

Compound Q&A

What industries use Diphenylphosphinic acid (CAS: 1707-03-5)?

Diphenylphosphinic acid (CAS: 1707-03-5) is used in various industries, including pharmaceuticals fo...

Compound Q&A

What precautions should be taken when handling Diphenylphosphinic acid (CAS: 1707-03-5)?

When handling Diphenylphosphinic acid (CAS: 1707-03-5), it is important to use personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...