Compound Q&A

What precautions should be taken when handling Benzyl serinate hydrochloride (CAS: 60022-62-0)?

Answer

Benzyl serinate hydrochloride (1:1)
When handling Benzyl serinate hydrochloride (CAS: 60022-62-0), it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work in a well-ventilated area or a fume hood to minimize exposure. Avoid contact with skin and eyes. In case of a spill, immediately clean up the area using appropriate absorbent materials and follow safety guidelines. Always refer to the Material Safety Data Sheet (MSDS) for detailed safety information.

About

CAS No 60022-62-0
English Name Benzyl serinate hydrochloride (1:1)
Molecular Formula C10H14ClNO3
Molecular Weight 231.68 g/mol
SMILES C1=CC=C(C=C1)COC(=O)C(CO)N.Cl
InChIKey MGZWCDQAKCHOBX-FVGYRXGTSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of Benzyl serinate hydrochloride (CAS: 60022-62-0)?

Benzyl serinate hydrochloride (CAS: 60022-62-0) is a crystalline solid. It has a molecular weight of...

Compound Q&A

How is Benzyl serinate hydrochloride (CAS: 60022-62-0) typically synthesized?

Benzyl serinate hydrochloride (CAS: 60022-62-0) is typically synthesized by the reaction of benzyl s...

Compound Q&A

What industries use Benzyl serinate hydrochloride (CAS: 60022-62-0)?

Benzyl serinate hydrochloride (CAS: 60022-62-0) is primarily used in the pharmaceutical industry for...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...