Compound Q&A

How is Benzyl serinate hydrochloride (CAS: 60022-62-0) typically synthesized?

Answer

Benzyl serinate hydrochloride (1:1)
Benzyl serinate hydrochloride (CAS: 60022-62-0) is typically synthesized by the reaction of benzyl serine with hydrochloric acid. The reaction is carried out under mild conditions, and the product is obtained in good yield. The process involves the formation of a salt between the carboxylic acid group of benzyl serine and hydrochloric acid. The reaction is selective and yields the desired product with high purity.

About

CAS No 60022-62-0
English Name Benzyl serinate hydrochloride (1:1)
Molecular Formula C10H14ClNO3
Molecular Weight 231.68 g/mol
SMILES C1=CC=C(C=C1)COC(=O)C(CO)N.Cl
InChIKey MGZWCDQAKCHOBX-FVGYRXGTSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of Benzyl serinate hydrochloride (CAS: 60022-62-0)?

Benzyl serinate hydrochloride (CAS: 60022-62-0) is a crystalline solid. It has a molecular weight of...

Compound Q&A

What industries use Benzyl serinate hydrochloride (CAS: 60022-62-0)?

Benzyl serinate hydrochloride (CAS: 60022-62-0) is primarily used in the pharmaceutical industry for...

Compound Q&A

What precautions should be taken when handling Benzyl serinate hydrochloride (CAS: 60022-62-0)?

When handling Benzyl serinate hydrochloride (CAS: 60022-62-0), it is essential to wear appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...