Compound Q&A

What industries use Benzyl serinate hydrochloride (CAS: 60022-62-0)?

Answer

Benzyl serinate hydrochloride (1:1)
Benzyl serinate hydrochloride (CAS: 60022-62-0) is primarily used in the pharmaceutical industry for the synthesis of medication intermediates. It also finds applications in the polymer industry for modifying the properties of polymers. Additionally, it is utilized in the sensor and semiconductor industries for specific chemical sensing and electronic applications.

About

CAS No 60022-62-0
English Name Benzyl serinate hydrochloride (1:1)
Molecular Formula C10H14ClNO3
Molecular Weight 231.68 g/mol
SMILES C1=CC=C(C=C1)COC(=O)C(CO)N.Cl
InChIKey MGZWCDQAKCHOBX-FVGYRXGTSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of Benzyl serinate hydrochloride (CAS: 60022-62-0)?

Benzyl serinate hydrochloride (CAS: 60022-62-0) is a crystalline solid. It has a molecular weight of...

Compound Q&A

How is Benzyl serinate hydrochloride (CAS: 60022-62-0) typically synthesized?

Benzyl serinate hydrochloride (CAS: 60022-62-0) is typically synthesized by the reaction of benzyl s...

Compound Q&A

What precautions should be taken when handling Benzyl serinate hydrochloride (CAS: 60022-62-0)?

When handling Benzyl serinate hydrochloride (CAS: 60022-62-0), it is essential to wear appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...