Compound Q&A

What are the physical and chemical properties of Benzyl serinate hydrochloride (CAS: 60022-62-0)?

Answer

Benzyl serinate hydrochloride (1:1)
Benzyl serinate hydrochloride (CAS: 60022-62-0) is a crystalline solid. It has a molecular weight of approximately 409.78 g/mol. The compound is soluble in water and ethanol. It exhibits moderate reactivity, particularly under basic conditions, making it susceptible to hydrolysis. Benzyl serinate hydrochloride is stable under normal storage conditions but should be protected from moisture and heat.

About

CAS No 60022-62-0
English Name Benzyl serinate hydrochloride (1:1)
Molecular Formula C10H14ClNO3
Molecular Weight 231.68 g/mol
SMILES C1=CC=C(C=C1)COC(=O)C(CO)N.Cl
InChIKey MGZWCDQAKCHOBX-FVGYRXGTSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

How is Benzyl serinate hydrochloride (CAS: 60022-62-0) typically synthesized?

Benzyl serinate hydrochloride (CAS: 60022-62-0) is typically synthesized by the reaction of benzyl s...

Compound Q&A

What industries use Benzyl serinate hydrochloride (CAS: 60022-62-0)?

Benzyl serinate hydrochloride (CAS: 60022-62-0) is primarily used in the pharmaceutical industry for...

Compound Q&A

What precautions should be taken when handling Benzyl serinate hydrochloride (CAS: 60022-62-0)?

When handling Benzyl serinate hydrochloride (CAS: 60022-62-0), it is essential to wear appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...