Compound Q&A

What industries use 3-(4,5-Diphenyl-1,3-oxazol-2-yl)propanoic acid (CAS: 21256-18-8)?

Answer

3-(4,5-Diphenyl-1,3-oxazol-2-yl)propanoic acid
3-(4,5-Diphenyl-1,3-oxazol-2-yl)propanoic acid (CAS: 21256-18-8) is primarily used in the pharmaceutical industry for the synthesis of various bioactive compounds. It also finds application in the production of sensors, semiconductors, and as a precursor in the polymer industry. Its unique chemical structure makes it valuable in developing new materials and drugs.

About

CAS No 21256-18-8
English Name 3-(4,5-Diphenyl-1,3-oxazol-2-yl)propanoic acid
Molecular Formula C18H15NO3
Molecular Weight 293.32 g/mol
SMILES C1=CC=C(C=C1)C2=C(OC(=N2)CCC(=O)O)C3=CC=CC=C3
InChIKey OFPXSFXSNFPTHF-UHFFFAOYSA-N
Last Updated: 2025-09-05 16:09

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(4,5-Diphenyl-1,3-oxazol-2-yl)propanoic acid (CAS: 21256-18-8)?

3-(4,5-Diphenyl-1,3-oxazol-2-yl)propanoic acid (CAS: 21256-18-8) is a white crystalline solid with a...

Compound Q&A

How is 3-(4,5-Diphenyl-1,3-oxazol-2-yl)propanoic acid (CAS: 21256-18-8) typically synthesized?

3-(4,5-Diphenyl-1,3-oxazol-2-yl)propanoic acid can be synthesized by reacting 4,5-diphenyl-1,3-oxazo...

Compound Q&A

What precautions should be taken when handling 3-(4,5-Diphenyl-1,3-oxazol-2-yl)propanoic acid (CAS: 21256-18-8)?

When handling 3-(4,5-Diphenyl-1,3-oxazol-2-yl)propanoic acid (CAS: 21256-18-8), it is important to w...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...