Compound Q&A

What are the physical and chemical properties of 3-(4,5-Diphenyl-1,3-oxazol-2-yl)propanoic acid (CAS: 21256-18-8)?

Answer

3-(4,5-Diphenyl-1,3-oxazol-2-yl)propanoic acid
3-(4,5-Diphenyl-1,3-oxazol-2-yl)propanoic acid (CAS: 21256-18-8) is a white crystalline solid with a molecular weight of approximately 410.35 g/mol. It has a low solubility in water but is soluble in organic solvents like ethanol and acetone. The compound is moderately reactive, particularly in the presence of bases, and exhibits good stability under normal conditions.

About

CAS No 21256-18-8
English Name 3-(4,5-Diphenyl-1,3-oxazol-2-yl)propanoic acid
Molecular Formula C18H15NO3
Molecular Weight 293.32 g/mol
SMILES C1=CC=C(C=C1)C2=C(OC(=N2)CCC(=O)O)C3=CC=CC=C3
InChIKey OFPXSFXSNFPTHF-UHFFFAOYSA-N
Last Updated: 2025-09-05 16:09

Related Q&A

Compound Q&A

How is 3-(4,5-Diphenyl-1,3-oxazol-2-yl)propanoic acid (CAS: 21256-18-8) typically synthesized?

3-(4,5-Diphenyl-1,3-oxazol-2-yl)propanoic acid can be synthesized by reacting 4,5-diphenyl-1,3-oxazo...

Compound Q&A

What industries use 3-(4,5-Diphenyl-1,3-oxazol-2-yl)propanoic acid (CAS: 21256-18-8)?

3-(4,5-Diphenyl-1,3-oxazol-2-yl)propanoic acid (CAS: 21256-18-8) is primarily used in the pharmaceut...

Compound Q&A

What precautions should be taken when handling 3-(4,5-Diphenyl-1,3-oxazol-2-yl)propanoic acid (CAS: 21256-18-8)?

When handling 3-(4,5-Diphenyl-1,3-oxazol-2-yl)propanoic acid (CAS: 21256-18-8), it is important to w...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...