Compound Q&A

How should Combretastatin A4 (CAS: 117048-59-6) be stored?

Answer

Combretastatin A4
Combretastatin A4 should be stored in a cool, dry, and dark place, ideally at 4°C. It is recommended to keep it in a sealed container to prevent moisture and contamination. Avoid exposure to light and air to maintain its stability and potency. Proper storage conditions are essential to ensure the compound remains effective for research and potential therapeutic applications.

About

English Name Combretastatin A4
Molecular Formula C18H20O5
Molecular Weight 316.35 g/mol
SMILES COC1=C(C=C(C=C1)C=CC2=CC(=C(C(=C2)OC)OC)OC)O
InChIKey HVXBOLULGPECHP-WAYWQWQTSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is Combretastatin A4 (CAS: 117048-59-6)?

Combretastatin A4 is a natural compound derived from the African shrub *Combretum caffrum*. It has t...

Compound Q&A

What are the main uses of Combretastatin A4 (CAS: 117048-59-6)?

Combretastatin A4 is primarily used in pharmaceutical research for its anti-tumor properties. It has...

Compound Q&A

Is Combretastatin A4 (CAS: 117048-59-6) safe?

Combretastatin A4 is generally considered safe when handled properly in laboratory settings. However...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...