Compound Q&A

What is Combretastatin A4 (CAS: 117048-59-6)?

Answer

Combretastatin A4
Combretastatin A4 is a natural compound derived from the African shrub *Combretum caffrum*. It has the chemical formula C21H22O9 and is known for its potential anti-cancer properties. This compound belongs to the class of flavonoids and exhibits cytotoxic activity against various cancer cell lines. Combretastatin A4 is also used in research for its ability to inhibit microtubule assembly, making it a valuable tool in drug discovery and development.

About

English Name Combretastatin A4
Molecular Formula C18H20O5
Molecular Weight 316.35 g/mol
SMILES COC1=C(C=C(C=C1)C=CC2=CC(=C(C(=C2)OC)OC)OC)O
InChIKey HVXBOLULGPECHP-WAYWQWQTSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of Combretastatin A4 (CAS: 117048-59-6)?

Combretastatin A4 is primarily used in pharmaceutical research for its anti-tumor properties. It has...

Compound Q&A

Is Combretastatin A4 (CAS: 117048-59-6) safe?

Combretastatin A4 is generally considered safe when handled properly in laboratory settings. However...

Compound Q&A

How should Combretastatin A4 (CAS: 117048-59-6) be stored?

Combretastatin A4 should be stored in a cool, dry, and dark place, ideally at 4°C. It is recommended...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...