Compound Q&A

How should Schisandrin B (CAS: 61281-37-6) be stored?

Answer

Schisandrin B
Schisandrin B (CAS: 61281-37-6) should be stored in a cool, dry place (2-8°C), away from light and moisture. Keep in airtight containers to maintain stability and prevent degradation. Proper storage ensures its potency and safety for use in research, pharmaceuticals, and supplements.

About

CAS No 61281-37-6
English Name Schisandrin B
Molecular Formula C23H28O6
Molecular Weight 400.46 g/mol
SMILES COc1cc2C[C@H](C)[C@H](C)Cc3c(c2c(c1OC)OC)c(OC)c1c(c3)OCO1
InChIKey RTZKSTLPRTWFEV-QWHCGFSZSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is Schisandrin B (CAS: 61281-37-6)?

Schisandrin B (CAS: 61281-37-6) is a lignan compound derived from the Chinese herb Schisandra chinen...

Compound Q&A

What are the main uses of Schisandrin B (CAS: 61281-37-6)?

Schisandrin B (CAS: 61281-37-6) is primarily used in pharmaceuticals for its antioxidant and anti-in...

Compound Q&A

Is Schisandrin B (CAS: 61281-37-6) safe?

Schisandrin B (CAS: 61281-37-6) is considered safe when used in recommended doses and under proper h...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...