Compound Q&A

What are the main uses of Schisandrin B (CAS: 61281-37-6)?

Answer

Schisandrin B
Schisandrin B (CAS: 61281-37-6) is primarily used in pharmaceuticals for its antioxidant and anti-inflammatory effects, supporting liver health and neuroprotection. It is also incorporated into dietary supplements and traditional herbal formulations. Research applications include studying its potential in drug development for chronic diseases and its role as a bioactive compound in plant-based therapies.

About

CAS No 61281-37-6
English Name Schisandrin B
Molecular Formula C23H28O6
Molecular Weight 400.46 g/mol
SMILES COc1cc2C[C@H](C)[C@H](C)Cc3c(c2c(c1OC)OC)c(OC)c1c(c3)OCO1
InChIKey RTZKSTLPRTWFEV-QWHCGFSZSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is Schisandrin B (CAS: 61281-37-6)?

Schisandrin B (CAS: 61281-37-6) is a lignan compound derived from the Chinese herb Schisandra chinen...

Compound Q&A

Is Schisandrin B (CAS: 61281-37-6) safe?

Schisandrin B (CAS: 61281-37-6) is considered safe when used in recommended doses and under proper h...

Compound Q&A

How should Schisandrin B (CAS: 61281-37-6) be stored?

Schisandrin B (CAS: 61281-37-6) should be stored in a cool, dry place (2-8°C), away from light and m...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...