Compound Q&A

Is Schisandrin B (CAS: 61281-37-6) safe?

Answer

Schisandrin B
Schisandrin B (CAS: 61281-37-6) is considered safe when used in recommended doses and under proper handling conditions. While it has low toxicity, prolonged exposure or high concentrations may cause irritation. Safety standards ensure its use in pharmaceuticals and food supplements, but protective measures like gloves and ventilation are advised during handling.

About

CAS No 61281-37-6
English Name Schisandrin B
Molecular Formula C23H28O6
Molecular Weight 400.46 g/mol
SMILES COc1cc2C[C@H](C)[C@H](C)Cc3c(c2c(c1OC)OC)c(OC)c1c(c3)OCO1
InChIKey RTZKSTLPRTWFEV-QWHCGFSZSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is Schisandrin B (CAS: 61281-37-6)?

Schisandrin B (CAS: 61281-37-6) is a lignan compound derived from the Chinese herb Schisandra chinen...

Compound Q&A

What are the main uses of Schisandrin B (CAS: 61281-37-6)?

Schisandrin B (CAS: 61281-37-6) is primarily used in pharmaceuticals for its antioxidant and anti-in...

Compound Q&A

How should Schisandrin B (CAS: 61281-37-6) be stored?

Schisandrin B (CAS: 61281-37-6) should be stored in a cool, dry place (2-8°C), away from light and m...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...