Compound Q&A

What is Schisandrin B (CAS: 61281-37-6)?

Answer

Schisandrin B
Schisandrin B (CAS: 61281-37-6) is a lignan compound derived from the Chinese herb Schisandra chinensis. It has the chemical formula C21H26O6 and is known for its yellow crystalline appearance. Schisandrin B exhibits antioxidant, anti-inflammatory, and neuroprotective properties, making it a valuable component in natural medicine and scientific research.

About

CAS No 61281-37-6
English Name Schisandrin B
Molecular Formula C23H28O6
Molecular Weight 400.46 g/mol
SMILES COc1cc2C[C@H](C)[C@H](C)Cc3c(c2c(c1OC)OC)c(OC)c1c(c3)OCO1
InChIKey RTZKSTLPRTWFEV-QWHCGFSZSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of Schisandrin B (CAS: 61281-37-6)?

Schisandrin B (CAS: 61281-37-6) is primarily used in pharmaceuticals for its antioxidant and anti-in...

Compound Q&A

Is Schisandrin B (CAS: 61281-37-6) safe?

Schisandrin B (CAS: 61281-37-6) is considered safe when used in recommended doses and under proper h...

Compound Q&A

How should Schisandrin B (CAS: 61281-37-6) be stored?

Schisandrin B (CAS: 61281-37-6) should be stored in a cool, dry place (2-8°C), away from light and m...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...