Compound Q&A

How should N,N,N-Tributyl-1-butanaminium chloride (CAS: 1112-67-0) be stored?

Answer

N,N,N-Tributyl-1-butanaminium chloride
N,N,N-Tributyl-1-butanaminium chloride (CAS: 1112-67-0) should be stored in a cool, dry, and dark place, ideally at 25°C or below. Keep it in a sealed container to prevent moisture absorption, and avoid exposure to direct sunlight or heat sources. Ensure storage away from incompatible materials and maintain proper labeling to ensure stability and safety compliance.

About

CAS No 1112-67-0
English Name N,N,N-Tributyl-1-butanaminium chloride
Molecular Formula C16H36ClN
Molecular Weight 277.9167 g/mol
SMILES [Cl-].CCCC[N+](CCCC)(CCCC)CCCC
InChIKey NHGXDBSUJJNIRV-UHFFFAOYSA-M
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is N,N,N-Tributyl-1-butanaminium chloride (CAS: 1112-67-0)?

N,N,N-Tributyl-1-butanaminium chloride (CAS: 1112-67-0) is a quaternary ammonium chloride compound w...

Compound Q&A

What are the main uses of N,N,N-Tributyl-1-butanaminium chloride (CAS: 1112-67-0)?

N,N,N-Tributyl-1-butanaminium chloride (CAS: 1112-67-0) is primarily used in pharmaceuticals as a st...

Compound Q&A

Is N,N,N-Tributyl-1-butanaminium chloride (CAS: 1112-67-0) safe?

N,N,N-Tributyl-1-butanaminium chloride (CAS: 1112-67-0) is generally considered safe when handled pr...

Compound Q&A

How should waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane be handled?

Waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane (...

100751-65-3[(6-Bromo-2-naphthyl...
Compound Q&A

How is 7-Fluoro-4-isoquinolinecarboxylic acid (CAS: 1841081-40-0) typically synthesized?

7-Fluoro-4-isoquinolinecarboxylic acid can be synthesized via a multi-step proce...

1841081-40-07-Fluoro-4-isoquinol...
Compound Q&A

What are the physical and chemical properties of 2,3,5,6-Tetrabromothieno[3,2-b]thiophene (CAS: 124638-53-5)?

2,3,5,6-Tetrabromothieno[3,2-b]thiophene is a crystalline compound with a high m...

124638-53-52,3,5,6-Tetrabromoth...
Compound Q&A

Is 1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indole-4-carboxamide (CAS: 1542705-92-9) safe?

1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indol...

1542705-92-91-[4-(Benzylamino)-7...