Compound Q&A

Is N,N,N-Tributyl-1-butanaminium chloride (CAS: 1112-67-0) safe?

Answer

N,N,N-Tributyl-1-butanaminium chloride
N,N,N-Tributyl-1-butanaminium chloride (CAS: 1112-67-0) is generally considered safe when handled properly. However, it may cause skin and eye irritation, and prolonged exposure can lead to respiratory issues. Safety data sheets (SDS) recommend using personal protective equipment (PPE), ensuring proper ventilation, and avoiding direct contact. It is classified as a mild irritant and should comply with OSHA and EPA guidelines for chemical handling.

About

CAS No 1112-67-0
English Name N,N,N-Tributyl-1-butanaminium chloride
Molecular Formula C16H36ClN
Molecular Weight 277.9167 g/mol
SMILES [Cl-].CCCC[N+](CCCC)(CCCC)CCCC
InChIKey NHGXDBSUJJNIRV-UHFFFAOYSA-M
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is N,N,N-Tributyl-1-butanaminium chloride (CAS: 1112-67-0)?

N,N,N-Tributyl-1-butanaminium chloride (CAS: 1112-67-0) is a quaternary ammonium chloride compound w...

Compound Q&A

What are the main uses of N,N,N-Tributyl-1-butanaminium chloride (CAS: 1112-67-0)?

N,N,N-Tributyl-1-butanaminium chloride (CAS: 1112-67-0) is primarily used in pharmaceuticals as a st...

Compound Q&A

How should N,N,N-Tributyl-1-butanaminium chloride (CAS: 1112-67-0) be stored?

N,N,N-Tributyl-1-butanaminium chloride (CAS: 1112-67-0) should be stored in a cool, dry, and dark pl...

Compound Q&A

How should waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane be handled?

Waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane (...

100751-65-3[(6-Bromo-2-naphthyl...
Compound Q&A

How is 7-Fluoro-4-isoquinolinecarboxylic acid (CAS: 1841081-40-0) typically synthesized?

7-Fluoro-4-isoquinolinecarboxylic acid can be synthesized via a multi-step proce...

1841081-40-07-Fluoro-4-isoquinol...
Compound Q&A

What are the physical and chemical properties of 2,3,5,6-Tetrabromothieno[3,2-b]thiophene (CAS: 124638-53-5)?

2,3,5,6-Tetrabromothieno[3,2-b]thiophene is a crystalline compound with a high m...

124638-53-52,3,5,6-Tetrabromoth...
Compound Q&A

Is 1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indole-4-carboxamide (CAS: 1542705-92-9) safe?

1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indol...

1542705-92-91-[4-(Benzylamino)-7...