Compound Q&A

What are the main uses of N,N,N-Tributyl-1-butanaminium chloride (CAS: 1112-67-0)?

Answer

N,N,N-Tributyl-1-butanaminium chloride
N,N,N-Tributyl-1-butanaminium chloride (CAS: 1112-67-0) is primarily used in pharmaceuticals as a stabilizing agent and in industrial applications for its surfactant properties. It serves as a phase transfer catalyst in organic synthesis and is employed in the production of detergents, emulsifiers, and antistatic agents. Additionally, it finds niche use in research for its ability to interact with biological membranes and in some specialized chemical formulations.

About

CAS No 1112-67-0
English Name N,N,N-Tributyl-1-butanaminium chloride
Molecular Formula C16H36ClN
Molecular Weight 277.92 g/mol
SMILES [Cl-].CCCC[N+](CCCC)(CCCC)CCCC
InChIKey NHGXDBSUJJNIRV-UHFFFAOYSA-M
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is N,N,N-Tributyl-1-butanaminium chloride (CAS: 1112-67-0)?

N,N,N-Tributyl-1-butanaminium chloride (CAS: 1112-67-0) is a quaternary ammonium chloride compound w...

Compound Q&A

Is N,N,N-Tributyl-1-butanaminium chloride (CAS: 1112-67-0) safe?

N,N,N-Tributyl-1-butanaminium chloride (CAS: 1112-67-0) is generally considered safe when handled pr...

Compound Q&A

How should N,N,N-Tributyl-1-butanaminium chloride (CAS: 1112-67-0) be stored?

N,N,N-Tributyl-1-butanaminium chloride (CAS: 1112-67-0) should be stored in a cool, dry, and dark pl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...