Compound Q&A

What is N,N,N-Tributyl-1-butanaminium chloride (CAS: 1112-67-0)?

Answer

N,N,N-Tributyl-1-butanaminium chloride
N,N,N-Tributyl-1-butanaminium chloride (CAS: 1112-67-0) is a quaternary ammonium chloride compound with the chemical formula C16H37NCl. It features three butyl groups attached to a nitrogen atom in a butanaminium structure, forming a cationic surfactant. This compound is typically a viscous liquid with a mild amine odor, soluble in water and organic solvents, and exhibits basic properties due to its ammonium chloride salt form.

About

CAS No 1112-67-0
English Name N,N,N-Tributyl-1-butanaminium chloride
Molecular Formula C16H36ClN
Molecular Weight 277.9167 g/mol
SMILES [Cl-].CCCC[N+](CCCC)(CCCC)CCCC
InChIKey NHGXDBSUJJNIRV-UHFFFAOYSA-M
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of N,N,N-Tributyl-1-butanaminium chloride (CAS: 1112-67-0)?

N,N,N-Tributyl-1-butanaminium chloride (CAS: 1112-67-0) is primarily used in pharmaceuticals as a st...

Compound Q&A

Is N,N,N-Tributyl-1-butanaminium chloride (CAS: 1112-67-0) safe?

N,N,N-Tributyl-1-butanaminium chloride (CAS: 1112-67-0) is generally considered safe when handled pr...

Compound Q&A

How should N,N,N-Tributyl-1-butanaminium chloride (CAS: 1112-67-0) be stored?

N,N,N-Tributyl-1-butanaminium chloride (CAS: 1112-67-0) should be stored in a cool, dry, and dark pl...

Compound Q&A

How should waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane be handled?

Waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane (...

100751-65-3[(6-Bromo-2-naphthyl...
Compound Q&A

How is 7-Fluoro-4-isoquinolinecarboxylic acid (CAS: 1841081-40-0) typically synthesized?

7-Fluoro-4-isoquinolinecarboxylic acid can be synthesized via a multi-step proce...

1841081-40-07-Fluoro-4-isoquinol...
Compound Q&A

What are the physical and chemical properties of 2,3,5,6-Tetrabromothieno[3,2-b]thiophene (CAS: 124638-53-5)?

2,3,5,6-Tetrabromothieno[3,2-b]thiophene is a crystalline compound with a high m...

124638-53-52,3,5,6-Tetrabromoth...
Compound Q&A

Is 1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indole-4-carboxamide (CAS: 1542705-92-9) safe?

1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indol...

1542705-92-91-[4-(Benzylamino)-7...