Compound Q&A

What is N,N,N-Tributyl-1-butanaminium chloride (CAS: 1112-67-0)?

Answer

N,N,N-Tributyl-1-butanaminium chloride
N,N,N-Tributyl-1-butanaminium chloride (CAS: 1112-67-0) is a quaternary ammonium chloride compound with the chemical formula C16H37NCl. It features three butyl groups attached to a nitrogen atom in a butanaminium structure, forming a cationic surfactant. This compound is typically a viscous liquid with a mild amine odor, soluble in water and organic solvents, and exhibits basic properties due to its ammonium chloride salt form.

About

CAS No 1112-67-0
English Name N,N,N-Tributyl-1-butanaminium chloride
Molecular Formula C16H36ClN
Molecular Weight 277.92 g/mol
SMILES [Cl-].CCCC[N+](CCCC)(CCCC)CCCC
InChIKey NHGXDBSUJJNIRV-UHFFFAOYSA-M
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of N,N,N-Tributyl-1-butanaminium chloride (CAS: 1112-67-0)?

N,N,N-Tributyl-1-butanaminium chloride (CAS: 1112-67-0) is primarily used in pharmaceuticals as a st...

Compound Q&A

Is N,N,N-Tributyl-1-butanaminium chloride (CAS: 1112-67-0) safe?

N,N,N-Tributyl-1-butanaminium chloride (CAS: 1112-67-0) is generally considered safe when handled pr...

Compound Q&A

How should N,N,N-Tributyl-1-butanaminium chloride (CAS: 1112-67-0) be stored?

N,N,N-Tributyl-1-butanaminium chloride (CAS: 1112-67-0) should be stored in a cool, dry, and dark pl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...