Compound Q&A

How should 1,3-Dioxo-1,3-dihydro-2-benzofuran-5-carboxylic acid (CAS: 552-30-7) be stored?

Answer

1,3-Dioxo-1,3-dihydro-2-benzofuran-5-carboxylic acid
1,3-Dioxo-1,3-dihydro-2-benzofuran-5-carboxylic acid (CAS: 552-30-7) should be stored in a cool, dry place, away from light and moisture. It is typically kept in airtight containers to maintain stability and prevent degradation. Storage conditions should avoid exposure to high temperatures and humidity, ensuring long-term preservation of its chemical properties.

About

CAS No 552-30-7
English Name 1,3-Dioxo-1,3-dihydro-2-benzofuran-5-carboxylic acid
Molecular Formula C9H4O5
Molecular Weight 192.13 g/mol
SMILES OC(=O)c1ccc2C(=O)OC(=O)c2c1
InChIKey SRPWOOOHEPICQU-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 1,3-Dioxo-1,3-dihydro-2-benzofuran-5-carboxylic acid (CAS: 552-30-7)?

1,3-Dioxo-1,3-dihydro-2-benzofuran-5-carboxylic acid (CAS: 552-30-7) is a synthetic organic compound...

Compound Q&A

What are the main uses of 1,3-Dioxo-1,3-dihydro-2-benzofuran-5-carboxylic acid (CAS: 552-30-7)?

1,3-Dioxo-1,3-dihydro-2-benzofuran-5-carboxylic acid (CAS: 552-30-7) is primarily used in pharmaceut...

Compound Q&A

Is 1,3-Dioxo-1,3-dihydro-2-benzofuran-5-carboxylic acid (CAS: 552-30-7) safe?

1,3-Dioxo-1,3-dihydro-2-benzofuran-5-carboxylic acid (CAS: 552-30-7) is generally considered safe wh...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...