Compound Q&A

What are the main uses of 1,3-Dioxo-1,3-dihydro-2-benzofuran-5-carboxylic acid (CAS: 552-30-7)?

Answer

1,3-Dioxo-1,3-dihydro-2-benzofuran-5-carboxylic acid
1,3-Dioxo-1,3-dihydro-2-benzofuran-5-carboxylic acid (CAS: 552-30-7) is primarily used in pharmaceutical research as a key component in the development of antidiabetic and anti-inflammatory drugs. It also serves as an industrial chemical intermediate and is utilized in organic synthesis for creating bioactive molecules. Its unique structure makes it relevant in research for studying metabolic pathways and drug interactions.

About

CAS No 552-30-7
English Name 1,3-Dioxo-1,3-dihydro-2-benzofuran-5-carboxylic acid
Molecular Formula C9H4O5
Molecular Weight 192.13 g/mol
SMILES OC(=O)c1ccc2C(=O)OC(=O)c2c1
InChIKey SRPWOOOHEPICQU-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 1,3-Dioxo-1,3-dihydro-2-benzofuran-5-carboxylic acid (CAS: 552-30-7)?

1,3-Dioxo-1,3-dihydro-2-benzofuran-5-carboxylic acid (CAS: 552-30-7) is a synthetic organic compound...

Compound Q&A

Is 1,3-Dioxo-1,3-dihydro-2-benzofuran-5-carboxylic acid (CAS: 552-30-7) safe?

1,3-Dioxo-1,3-dihydro-2-benzofuran-5-carboxylic acid (CAS: 552-30-7) is generally considered safe wh...

Compound Q&A

How should 1,3-Dioxo-1,3-dihydro-2-benzofuran-5-carboxylic acid (CAS: 552-30-7) be stored?

1,3-Dioxo-1,3-dihydro-2-benzofuran-5-carboxylic acid (CAS: 552-30-7) should be stored in a cool, dry...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...