Compound Q&A

Is 1,3-Dioxo-1,3-dihydro-2-benzofuran-5-carboxylic acid (CAS: 552-30-7) safe?

Answer

1,3-Dioxo-1,3-dihydro-2-benzofuran-5-carboxylic acid
1,3-Dioxo-1,3-dihydro-2-benzofuran-5-carboxylic acid (CAS: 552-30-7) is generally considered safe when handled properly in controlled environments. However, it may cause skin or eye irritation, so protective gloves, goggles, and ventilation are recommended. Safety standards emphasize adherence to standard chemical handling protocols, and it is classified as a research chemical with appropriate lab safety measures in place.

About

CAS No 552-30-7
English Name 1,3-Dioxo-1,3-dihydro-2-benzofuran-5-carboxylic acid
Molecular Formula C9H4O5
Molecular Weight 192.13 g/mol
SMILES OC(=O)c1ccc2C(=O)OC(=O)c2c1
InChIKey SRPWOOOHEPICQU-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 1,3-Dioxo-1,3-dihydro-2-benzofuran-5-carboxylic acid (CAS: 552-30-7)?

1,3-Dioxo-1,3-dihydro-2-benzofuran-5-carboxylic acid (CAS: 552-30-7) is a synthetic organic compound...

Compound Q&A

What are the main uses of 1,3-Dioxo-1,3-dihydro-2-benzofuran-5-carboxylic acid (CAS: 552-30-7)?

1,3-Dioxo-1,3-dihydro-2-benzofuran-5-carboxylic acid (CAS: 552-30-7) is primarily used in pharmaceut...

Compound Q&A

How should 1,3-Dioxo-1,3-dihydro-2-benzofuran-5-carboxylic acid (CAS: 552-30-7) be stored?

1,3-Dioxo-1,3-dihydro-2-benzofuran-5-carboxylic acid (CAS: 552-30-7) should be stored in a cool, dry...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...