Compound Q&A

What is 1,3-Dioxo-1,3-dihydro-2-benzofuran-5-carboxylic acid (CAS: 552-30-7)?

Answer

1,3-Dioxo-1,3-dihydro-2-benzofuran-5-carboxylic acid
1,3-Dioxo-1,3-dihydro-2-benzofuran-5-carboxylic acid (CAS: 552-30-7) is a synthetic organic compound with the molecular formula C9H6O5. It is a white crystalline solid, known for its stability and reactivity in chemical reactions. The compound contains a benzofuran ring with two ketone groups and a carboxylic acid functional group, making it a valuable intermediate in pharmaceutical and chemical synthesis applications.

About

CAS No 552-30-7
English Name 1,3-Dioxo-1,3-dihydro-2-benzofuran-5-carboxylic acid
Molecular Formula C9H4O5
Molecular Weight 192.13 g/mol
SMILES OC(=O)c1ccc2C(=O)OC(=O)c2c1
InChIKey SRPWOOOHEPICQU-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of 1,3-Dioxo-1,3-dihydro-2-benzofuran-5-carboxylic acid (CAS: 552-30-7)?

1,3-Dioxo-1,3-dihydro-2-benzofuran-5-carboxylic acid (CAS: 552-30-7) is primarily used in pharmaceut...

Compound Q&A

Is 1,3-Dioxo-1,3-dihydro-2-benzofuran-5-carboxylic acid (CAS: 552-30-7) safe?

1,3-Dioxo-1,3-dihydro-2-benzofuran-5-carboxylic acid (CAS: 552-30-7) is generally considered safe wh...

Compound Q&A

How should 1,3-Dioxo-1,3-dihydro-2-benzofuran-5-carboxylic acid (CAS: 552-30-7) be stored?

1,3-Dioxo-1,3-dihydro-2-benzofuran-5-carboxylic acid (CAS: 552-30-7) should be stored in a cool, dry...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...