Compound Q&A

Is Albendazole EP Impurity B (CAS: 54029-12-8) safe?

Answer

Albendazole EP Impurity B (Albendazole Sulfoxide, Ricobendazole)
Albendazole EP Impurity B is considered less toxic than its parent compound, Albendazole, but safety precautions are still necessary. It should be handled with care, using gloves and ventilation to avoid skin or respiratory exposure. Limited data suggest it may pose risks if ingested or inhaled in large quantities. Always follow safety guidelines from regulatory bodies like the FDA and ensure proper disposal to minimize environmental impact.

About

CAS No 54029-12-8
English Name Albendazole EP Impurity B (Albendazole Sulfoxide, Ricobendazole)
Molecular Formula C12H15N3O3S
Molecular Weight 281.34 g/mol
SMILES CCCS(=O)C1=CC2=C(C=C1)N=C(N2)NC(=O)OC
InChIKey VXTGHWHFYNYFFV-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What is Albendazole EP Impurity B (CAS: 54029-12-8)?

Albendazole EP Impurity B, also known as Albendazole Sulfoxide or Ricobendazole, is a chemical compo...

Compound Q&A

What are the main uses of Albendazole EP Impurity B (CAS: 54029-12-8)?

Albendazole EP Impurity B is primarily used in pharmaceutical research to identify and quantify impu...

Compound Q&A

How should Albendazole EP Impurity B (CAS: 54029-12-8) be stored?

Albendazole EP Impurity B should be stored in a cool, dry place, away from light and moisture, in a ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...