Compound Q&A

What are the main uses of Albendazole EP Impurity B (CAS: 54029-12-8)?

Answer

Albendazole EP Impurity B (Albendazole Sulfoxide, Ricobendazole)
Albendazole EP Impurity B is primarily used in pharmaceutical research to identify and quantify impurities during the synthesis of Albendazole, an antiparasitic medication. It may also serve as a reference standard for analytical testing. Additionally, it is studied in chemical research for understanding oxidation pathways in benzimidazole compounds. Its applications are limited to controlled industrial and research settings due to its role as a byproduct in drug manufacturing.

About

CAS No 54029-12-8
English Name Albendazole EP Impurity B (Albendazole Sulfoxide, Ricobendazole)
Molecular Formula C12H15N3O3S
Molecular Weight 281.34 g/mol
SMILES CCCS(=O)C1=CC2=C(C=C1)N=C(N2)NC(=O)OC
InChIKey VXTGHWHFYNYFFV-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What is Albendazole EP Impurity B (CAS: 54029-12-8)?

Albendazole EP Impurity B, also known as Albendazole Sulfoxide or Ricobendazole, is a chemical compo...

Compound Q&A

Is Albendazole EP Impurity B (CAS: 54029-12-8) safe?

Albendazole EP Impurity B is considered less toxic than its parent compound, Albendazole, but safety...

Compound Q&A

How should Albendazole EP Impurity B (CAS: 54029-12-8) be stored?

Albendazole EP Impurity B should be stored in a cool, dry place, away from light and moisture, in a ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...