Compound Q&A

What is Albendazole EP Impurity B (CAS: 54029-12-8)?

Answer

Albendazole EP Impurity B (Albendazole Sulfoxide, Ricobendazole)
Albendazole EP Impurity B, also known as Albendazole Sulfoxide or Ricobendazole, is a chemical compound with the formula C13H15N3O2S. It is a sulfur-containing derivative of Albendazole, commonly used as an impurity in pharmaceutical production. This compound exhibits low solubility in water and is typically a solid at room temperature. Its structure resembles Albendazole but includes a sulfoxide functional group, making it relevant in drug development and quality control.

About

CAS No 54029-12-8
English Name Albendazole EP Impurity B (Albendazole Sulfoxide, Ricobendazole)
Molecular Formula C12H15N3O3S
Molecular Weight 281.34 g/mol
SMILES CCCS(=O)C1=CC2=C(C=C1)N=C(N2)NC(=O)OC
InChIKey VXTGHWHFYNYFFV-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What are the main uses of Albendazole EP Impurity B (CAS: 54029-12-8)?

Albendazole EP Impurity B is primarily used in pharmaceutical research to identify and quantify impu...

Compound Q&A

Is Albendazole EP Impurity B (CAS: 54029-12-8) safe?

Albendazole EP Impurity B is considered less toxic than its parent compound, Albendazole, but safety...

Compound Q&A

How should Albendazole EP Impurity B (CAS: 54029-12-8) be stored?

Albendazole EP Impurity B should be stored in a cool, dry place, away from light and moisture, in a ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...