Compound Q&A

Is Ivermectin (CAS: 70288-86-7) safe?

Answer

Ivermectin
Ivermectin (CAS: 70288-86-7) is generally safe when used as directed, but improper handling may cause toxicity. It is a prescription medication, and overdose can lead to adverse effects like dizziness or gastrointestinal issues. Protective measures, such as gloves and goggles, are recommended during handling. Safety standards ensure its efficacy and minimize risks, emphasizing adherence to medical guidelines for human and animal use.

About

CAS No 70288-86-7
English Name Ivermectin
Molecular Formula C48H74O14
Molecular Weight 875.11 g/mol
SMILES CC[C@@H](C)[C@H]1O[C@]2(CC[C@@H]1C)C[C@@H]3C[C@@H](CC=C(C)[C@@H](O[C@H]4C[C@H](OC)[C@@H](O[C@H]5C[C@H](OC)[C@@H](O)[C@H](C)O5)[C@H](C)O4)[C@@H](C)C=CC=C6CO[C@@H]7[C@H](O)C(=C[C@@H](C(=O)O3)[C@@]76O)C)O2
InChIKey AZSNMRSAGSSBNP-NQSNVJSVSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What is Ivermectin (CAS: 70288-86-7)?

Ivermectin (CAS: 70288-86-7) is an antiparasitic compound classified as a macrocyclic lactone. Its c...

Compound Q&A

What are the main uses of Ivermectin (CAS: 70288-86-7)?

Ivermectin (CAS: 70288-86-7) is primarily used to treat parasitic infections in humans and animals, ...

Compound Q&A

How should Ivermectin (CAS: 70288-86-7) be stored?

Ivermectin (CAS: 70288-86-7) should be stored in a cool, dry place away from light, typically at 20-...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...