Compound Q&A

What is Ivermectin (CAS: 70288-86-7)?

Answer

Ivermectin
Ivermectin (CAS: 70288-86-7) is an antiparasitic compound classified as a macrocyclic lactone. Its chemical formula is C22H39NO12, and it exhibits high solubility in ethanol. Ivermectin is known for its broad-spectrum activity against nematodes and arthropods. It is widely used in veterinary medicine and human healthcare for treating parasitic infections. The compound’s structure contributes to its efficacy as a deworming agent, making it a key component in various pharmaceutical formulations.

About

CAS No 70288-86-7
English Name Ivermectin
Molecular Formula C48H74O14
Molecular Weight 875.11 g/mol
SMILES CC[C@@H](C)[C@H]1O[C@]2(CC[C@@H]1C)C[C@@H]3C[C@@H](CC=C(C)[C@@H](O[C@H]4C[C@H](OC)[C@@H](O[C@H]5C[C@H](OC)[C@@H](O)[C@H](C)O5)[C@H](C)O4)[C@@H](C)C=CC=C6CO[C@@H]7[C@H](O)C(=C[C@@H](C(=O)O3)[C@@]76O)C)O2
InChIKey AZSNMRSAGSSBNP-NQSNVJSVSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What are the main uses of Ivermectin (CAS: 70288-86-7)?

Ivermectin (CAS: 70288-86-7) is primarily used to treat parasitic infections in humans and animals, ...

Compound Q&A

Is Ivermectin (CAS: 70288-86-7) safe?

Ivermectin (CAS: 70288-86-7) is generally safe when used as directed, but improper handling may caus...

Compound Q&A

How should Ivermectin (CAS: 70288-86-7) be stored?

Ivermectin (CAS: 70288-86-7) should be stored in a cool, dry place away from light, typically at 20-...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...