Compound Q&A

What are the main uses of Ivermectin (CAS: 70288-86-7)?

Answer

Ivermectin
Ivermectin (CAS: 70288-86-7) is primarily used to treat parasitic infections in humans and animals, such as onchocerciasis, strongyloidiasis, and scabies. It is also applied in veterinary medicine for livestock and pets. In agriculture, it serves as a pesticide to control nematodes. Additionally, it has been explored for antiviral and anti-inflammatory research. Its versatility in combating parasites makes it a critical drug in public health and livestock management.

About

CAS No 70288-86-7
English Name Ivermectin
Molecular Formula C48H74O14
Molecular Weight 875.11 g/mol
SMILES CC[C@@H](C)[C@H]1O[C@]2(CC[C@@H]1C)C[C@@H]3C[C@@H](CC=C(C)[C@@H](O[C@H]4C[C@H](OC)[C@@H](O[C@H]5C[C@H](OC)[C@@H](O)[C@H](C)O5)[C@H](C)O4)[C@@H](C)C=CC=C6CO[C@@H]7[C@H](O)C(=C[C@@H](C(=O)O3)[C@@]76O)C)O2
InChIKey AZSNMRSAGSSBNP-NQSNVJSVSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What is Ivermectin (CAS: 70288-86-7)?

Ivermectin (CAS: 70288-86-7) is an antiparasitic compound classified as a macrocyclic lactone. Its c...

Compound Q&A

Is Ivermectin (CAS: 70288-86-7) safe?

Ivermectin (CAS: 70288-86-7) is generally safe when used as directed, but improper handling may caus...

Compound Q&A

How should Ivermectin (CAS: 70288-86-7) be stored?

Ivermectin (CAS: 70288-86-7) should be stored in a cool, dry place away from light, typically at 20-...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...