AD

Methyl [(2S)-1-{(2S)-2-[5-(4'-{2-[(2S)-1-{(2S)-2-[(methoxycarbonyl)amino]-3-methylbutanoyl}-2-pyrrolidinyl]-1H-imidazol-5-yl}-4-biphenylyl)-1H-imidazol-2-yl]-1-pyrrolidinyl}-3-methyl-1-oxo-2-butanyl]c arbamate(CAS: 1009119-64-5)

Methyl [(2S)-1-{(2S)-2-[5-(4'-{2-[(2S)-1-{(2S)-2-[(methoxycarbonyl)amino]-3-methylbutanoyl}-2-pyrrolidinyl]-1H-imidazol-5-yl}-4-biphenylyl)-1H-imidazol-2-yl]-1-pyrrolidinyl}-3-methyl-1-oxo-2-butanyl]c
arbamate
CAS Number

Related Products

Other Suppliers for Methyl [(2S)-1-{(2S)-2-[5-(4'-{2-[(2S)-1-{(2S)-2-[(methoxycarbonyl)amino]-3-methylbutanoyl}-2-pyrrolidinyl]-1H-imidazol-5-yl}-4-biphenylyl)-1H-imidazol-2-yl]-1-pyrrolidinyl}-3-methyl-1-oxo-2-butanyl]c arbamate

Basic Information

Molecular Formula
C40H50N8O6
Molecular Weight
738.89 g/mol

Physical Properties

Boiling Point
1071.2±65.0°C at 760 mmHg

Chemical Identifiers

SMILES
CC(C)[C@@H](C(=O)N1CCC[C@H]1c2[nH]c(cn2)c3ccc(cc3)c4ccc(cc4)c5cnc([nH]5)[C@@H]6CCCN6C(=O)[C@H](C(C)C)NC(=O)OC)NC(=O)OC
InChIKey
FKRSSPOQAMALKA-CUPIEXAXSA-N

Database References

MDL Number
MFCD18074519

FAQ

Methyl [(2S)-1-{(2S)-2-[5-(4'-{2-[(2S)-1-{(2S)-2-[(methoxycarbonyl)amino]-3-methylbutanoyl}-2-pyrrolidinyl]-1H-imidazol-5-yl}-4-biphenylyl)-1H-imidazol-2-yl]-1-pyrrolidinyl}-3-methyl-1-oxo-2-butanyl]carbamate (CAS: 1009119-64-5) is a complex organic compound containing multiple chiral centers, imidazole rings, and a carbamate functional group. It exhibits high molecular weight and is typically used in specialized chemical applications. Its structure suggests potential activity in biological systems, though specific properties require experimental validation.
This compound is primarily used in pharmaceutical research as a potential drug candidate or intermediate. Its complex structure, featuring imidazole and pyrrolidine rings, may target specific biological pathways, such as enzyme inhibition or receptor modulation. It is also employed in organic synthesis for developing compounds with tailored properties. Applications in industrial or food sectors are not well-documented due to its specialized nature.
Safety data for this compound is limited, but as a complex synthetic molecule, it should be handled with standard chemical safety precautions. Avoid inhalation, skin contact, and ingestion. Protective equipment like gloves, goggles, and a lab coat is recommended. Its toxicity profile requires further study, but it is generally not classified as highly hazardous. Always follow OSHA and EPA guidelines for chemical handling.
This compound should be stored in a cool, dry place (ideally 2-8°C), away from light and moisture. Keep it in airtight containers made of materials compatible with its chemical properties, such as glass or high-density polyethylene. Avoid exposure to heat or humidity to maintain stability. Storage conditions may vary based on specific formulation, so consult manufacturer guidelines for optimal preservation.

Safety Notice

Please verify product specifications and safety data before use. Contact the supplier for detailed safety information.

Always follow proper handling procedures

Contact Information

Contact Person

Lucy Zhao

Email

purchase03@wischem.net