1-[4-(Difluoromethoxy)phenyl]-1-propanone | CAS No. 83022-58-6

1-[4-(Difluoromethoxy)phenyl]-1-propanone

Basic Information

CAS Number

83022-58-6

Molecular Formula

C10H10F2O2

Molecular Weight

200.18 g/mol

AD

Basic Physical Properties

CCC(=O)c1ccc(cc1)OC(F)F

InChI

InChI=1S/C10H10F2O2/c1-2-9(13)7-3-5-8(6-4-7)14-10(11)12/h3-6,10H,2H2,1H3

InChIKey

NKRQQCHFLGGBJT-UHFFFAOYSA-N

LogP

2.880700000000001

Topological Polar Surface Area

26.3 Ų

Hydrogen Bond Donor/Acceptor

0 / 2

Synonyms & References

English

  • 1-[4-(difluoromethoxy)phenyl]propan-1-one
  • 1-(4-(Difluoromethoxy)phenyl)propan-1-one
  • 1-Propanone, 1-(4-(difluoromethoxy)phenyl)-

MDL Number

MFCD02725146

FAQ

What are the physical and chemical properties of 1-[4-(Difluoromethoxy)phenyl]-1-propanone (CAS: 83022-58-6)?

1-[4-(Difluoromethoxy)phenyl]-1-propanone (CAS: 83022-58-6) is a white crystalline solid with a molecular weight of approximately 228.2 g/mol. It has a high solubility in common organic solvents like dichloromethane and ethanol. This compound is reactive, particularly towards nucleophiles and can undergo electrophilic aromatic substitution reactions. It is used in organic synthesis as a precursor for various pharmaceuticals and materials.

How is 1-[4-(Difluoromethoxy)phenyl]-1-propanone (CAS: 83022-58-6) typically synthesized?

1-[4-(Difluoromethoxy)phenyl]-1-propanone (CAS: 83022-58-6) is typically synthesized via a Wittig reaction using 4-(difluoromethoxy)phenyltriphenylphosphonium bromide and methyl vinyl ketone. The process involves the formation of a ylide intermediate, followed by the nucleophilic attack on the ketone. The reaction can be catalyzed by a mild base, and yields of up to 90% can be achieved with proper control of reaction conditions.

What industries use 1-[4-(Difluoromethoxy)phenyl]-1-propanone (CAS: 83022-58-6)?

1-[4-(Difluoromethoxy)phenyl]-1-propanone (CAS: 83022-58-6) is primarily used in the pharmaceutical industry as a precursor for the synthesis of various drugs. It also finds applications in the polymer industry for the development of advanced materials. Additionally, this compound is utilized in the production of sensors and semiconductors due to its unique chemical properties and reactivity.

What precautions should be taken when handling 1-[4-(Difluoromethoxy)phenyl]-1-propanone (CAS: 83022-58-6)?

When handling 1-[4-(Difluoromethoxy)phenyl]-1-propanone (CAS: 83022-58-6), it is crucial to wear appropriate personal protective equipment (PPE), including gloves, safety glasses, and a lab coat. Handling should be done in a well-ventilated area or a fume hood to minimize inhalation exposure. Spills should be cleaned up immediately using appropriate absorbent materials. Always refer to the Material Safety Data Sheet (MSDS) for detailed safety information and emergency procedures.

You might also like

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...
Compound Q&A

What is 2-Oxopropanamide (CAS: 631-66-3)?

2-Oxopropanamide, also known as 2-aminoacrylic acid, is a chemical compound with...

631-66-32-Oxopropanamide
Compound Q&A

What is 2-Methyl-2-propanyl 4-(5-bromo-6-methyl-2-pyridinyl)-1-piperazinecarboxylate (CAS: 1289040-88-5)?

2-Methyl-2-propanyl 4-(5-bromo-6-methyl-2-pyridinyl)-1-piperazinecarboxylate (CA...

1289040-88-52-Methyl-2-propanyl ...
Compound Q&A

What is NAMPT inhibitor-linker 1 (CAS: 2241019-57-6)?

NAMPT inhibitor-linker 1 (CAS: 2241019-57-6) is a chemical compound designed as ...

2241019-57-6NAMPT inhibitor-link...
Compound Q&A

What is (2-(2,2,2-Trifluoroacetyl)pyridin-4-yl)boronic acid (CAS: 1310404-58-0)?

It is a chemical compound with the structure (2-(2,2,2-Trifluoroacetyl)pyridin-4...

1310404-58-0(2-(2,2,2-Trifluoroa...
Compound Q&A

What is 1-(2-Chlorophenyl)-6-(3,3,3-trifluoro-2-methylpropyl)-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one (CAS: 794568-90-4)?

1-(2-Chlorophenyl)-6-(3,3,3-trifluoro-2-methylpropyl)-1,5-dihydro-4H-pyrazolo[3,...

794568-90-41-(2-Chlorophenyl)-6...
Compound Q&A

What is Vinyl(chloromethyl)dimethoxysilane (CAS: 1314981-48-0)?

Vinyl(chloromethyl)dimethoxysilane is an organosilicon compound with the molecul...

1314981-48-0Vinyl(chloromethyl)d...