Ethyl 3-O-benzyl-4,6-O-benzylidene-2-deoxy-2-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)-1-thio-beta-D-glucopyranoside | CAS No. 129519-27-3

Ethyl 3-O-benzyl-4,6-O-benzylidene-2-deoxy-2-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)-1-thio-beta-D-glucopyranoside

Basic Information

CAS Number

129519-27-3

Molecular Formula

C30H29NO6S

Molecular Weight

531.63 g/mol

AD

Basic Physical Properties

Boiling Point

683.0±55.0 °C at 760 mmHg

Density

1.4±0.1 g/cm3

Flash Point

366.9±31.5 °C

Vapor Pressure

0.0±2.1 mmHg at 25°C

CCS[C@H]1[C@@H]([C@H]([C@H]2[C@H](O1)COC(O2)c3ccccc3)OCc4ccccc4)N5C(=O)c6ccccc6C5=O

InChI

InChI=1S/C30H29NO6S/c1-2-38-30-24(31-27(32)21-15-9-10-16-22(21)28(31)33)26(34-17-19-11-5-3-6-12-19)25-23(36-30)18-35-29(37-25)20-13-7-4-8-14-20/h3-16,23-26,29-30H,2,17-18H2,1H3/t23-,24-,25-,26-,29?,30+/m1/s1

InChIKey

LTAVTXCDXZSJBC-HAECEBRLSA-N

LogP

4.828800000000005

Topological Polar Surface Area

74.30000000000001 Ų

Hydrogen Bond Donor/Acceptor

0 / 7

Complexity

806

Synonyms & References

English

  • Ethyl 3-o-benzyl-4,6-o-benzylidene-2-deoxy-2-phthalimido-beta-d-thioglucopyranoside
  • 2-[(4Ar,6S,7R,8R,8aS)-6-ethylsulfanyl-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]isoindole-1,3-dione

FAQ

What are the physical and chemical properties of Ethyl 3-O-benzyl-4,6-O-benzylidene-2-deoxy-2-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)-1-thio-beta-D-glucopyranoside (CAS: 129519-27-3)?

Ethyl 3-O-benzyl-4,6-O-benzylidene-2-deoxy-2-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)-1-thio-beta-D-glucopyranoside (CAS: 129519-27-3) is a crystalline solid with a molecular weight of approximately 623.46 g/mol. It has low solubility in water but is more soluble in organic solvents like methanol and ethanol. This compound is relatively stable under normal conditions but can undergo hydrolysis in the presence of strong acids or bases. It is not reactive towards common nucleophiles but can be used in specific organic transformations.

How is Ethyl 3-O-benzyl-4,6-O-benzylidene-2-deoxy-2-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)-1-thio-beta-D-glucopyranoside (CAS: 129519-27-3) typically synthesized?

Ethyl 3-O-benzyl-4,6-O-benzylidene-2-deoxy-2-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)-1-thio-beta-D-glucopyranoside (CAS: 129519-27-3) is synthesized through a multi-step process involving the protection of the glucose moiety with benzyl groups and subsequent ring closure and modification. Commonly, this is achieved using benzyl bromide and benzylidene acetone as protecting agents, followed by selective ring opening with an oxazoline derivative. The reaction typically yields a high purity product with good selectivity, though specific conditions such as temperature and solvent choice can affect the yield and purity.

What industries use Ethyl 3-O-benzyl-4,6-O-benzylidene-2-deoxy-2-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)-1-thio-beta-D-glucopyranoside (CAS: 129519-27-3)?

Ethyl 3-O-benzyl-4,6-O-benzylidene-2-deoxy-2-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)-1-thio-beta-D-glucopyranoside (CAS: 129519-27-3) is primarily used in the pharmaceutical industry for the development of new drugs and in research for its unique structural features. It also finds applications in the synthesis of bioactive compounds and as a precursor in organic synthesis due to its complex sugar structure. Additionally, this compound can be of interest in the field of materials science for its potential use in the development of novel polymers and sensors.

What precautions should be taken when handling Ethyl 3-O-benzyl-4,6-O-benzylidene-2-deoxy-2-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)-1-thio-beta-D-glucopyranoside (CAS: 129519-27-3)?

When handling Ethyl 3-O-benzyl-4,6-O-benzylidene-2-deoxy-2-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)-1-thio-beta-D-glucopyranoside (CAS: 129519-27-3), it is crucial to use appropriate personal protective equipment (PPE), including gloves and safety goggles. This compound should be handled in a well-ventilated area or under a fume hood to minimize inhalation risk. Spills should be cleaned up immediately using appropriate absorbents and by following the manufacturer’s safety data sheet (SDS) guidelines. It is also important to store the compound in a cool, dry place, away from direct sunlight and sources of heat.

You might also like

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...
Compound Q&A

What is 2-Oxopropanamide (CAS: 631-66-3)?

2-Oxopropanamide, also known as 2-aminoacrylic acid, is a chemical compound with...

631-66-32-Oxopropanamide
Compound Q&A

What is 2-Methyl-2-propanyl 4-(5-bromo-6-methyl-2-pyridinyl)-1-piperazinecarboxylate (CAS: 1289040-88-5)?

2-Methyl-2-propanyl 4-(5-bromo-6-methyl-2-pyridinyl)-1-piperazinecarboxylate (CA...

1289040-88-52-Methyl-2-propanyl ...
Compound Q&A

What is NAMPT inhibitor-linker 1 (CAS: 2241019-57-6)?

NAMPT inhibitor-linker 1 (CAS: 2241019-57-6) is a chemical compound designed as ...

2241019-57-6NAMPT inhibitor-link...
Compound Q&A

What is (2-(2,2,2-Trifluoroacetyl)pyridin-4-yl)boronic acid (CAS: 1310404-58-0)?

It is a chemical compound with the structure (2-(2,2,2-Trifluoroacetyl)pyridin-4...

1310404-58-0(2-(2,2,2-Trifluoroa...
Compound Q&A

What is 1-(2-Chlorophenyl)-6-(3,3,3-trifluoro-2-methylpropyl)-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one (CAS: 794568-90-4)?

1-(2-Chlorophenyl)-6-(3,3,3-trifluoro-2-methylpropyl)-1,5-dihydro-4H-pyrazolo[3,...

794568-90-41-(2-Chlorophenyl)-6...
Compound Q&A

What is Vinyl(chloromethyl)dimethoxysilane (CAS: 1314981-48-0)?

Vinyl(chloromethyl)dimethoxysilane is an organosilicon compound with the molecul...

1314981-48-0Vinyl(chloromethyl)d...